![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 4015b.txt | 06-Jun-1997 11:48 | 1.7K | |
| 366083-701172-708588-0596005652-understandlk-chp-12.pdf | 04-Oct-2006 20:43 | 626K | |
| 366113-701187-708588-0596005652-understandlk-chp-18.pdf | 04-Oct-2006 21:15 | 583K | |
| Andrew.ppt | 09-Apr-1997 13:20 | 57K | |
| Crypto.ppt | 05-Aug-2002 21:20 | 53K | |
| DELL raid controller.doc | 16-Oct-2003 08:55 | 185K | |
| Date.htm | 19-Aug-2002 11:34 | 83K | |
| Distributed and Real Time Scheduling.ppt | 11-Mar-2003 12:20 | 69K | |
| File System Operations.ppt | 05-Aug-2002 21:21 | 56K | |
| File System Operations temp.ppt | 07-Oct-2003 08:54 | 31K | |
| Hackers guide.ppt | 05-Aug-2002 21:22 | 14K | |
| History and Structure.ppt | 24-Dec-2007 09:07 | 14K | |
| Incomplete.ppt | 27-Sep-1997 18:53 | 108K | |
| Intro.ppt | 14-Jan-2009 15:05 | 807K | |
| Java threads.ppt | 04-Sep-2003 08:06 | 89K | |
| Linear structures.ppt | 06-Jun-1996 14:23 | 76K | |
| Memory management.doc | 06-Sep-2007 07:19 | 28K | |
| Slide index.xls | 19-Dec-2006 18:35 | 21K | |
| Some System Calls Handled by tbe VFS.doc | 09-Oct-2003 08:56 | 37K | |
| Stevens message queue sample.ppt | 09-Sep-2003 08:19 | 54K | |
| Unix family tree.png | 29-Jul-2006 18:25 | 12K | |
| buffer cache.ppt | 17-Oct-2002 06:34 | 37K | |
| computing environment.ppt | 21-Aug-2005 21:10 | 47K | |
| config.aspx.html | 16-Oct-2003 09:01 | 83K | |
| config.aspx_files/ | 16-Jan-2007 20:55 | - | |
| critical section.ppt | 27-Jan-2004 11:05 | 32K | |
| deadlocks.ppt | 17-Sep-2002 07:30 | 49K | |
| distrib.ppt | 06-Nov-2002 21:23 | 967K | |
| ext2-3 file internals.ppt | 04-Oct-2006 22:59 | 95K | |
| file internals.ppt | 27-Mar-2003 13:24 | 90K | |
| file system-rubini.ppt | 04-Oct-2006 21:33 | 180K | |
| file system.ppt | 24-Sep-2006 20:32 | 79K | |
| file system chapter.ppt | 06-Oct-2008 14:40 | 613K | |
| file system chapter2.ppt | 13-Oct-2008 22:44 | 635K | |
| forkpage.txt | 02-Sep-2003 08:58 | 265K | |
| grades_s06.xls | 28-Mar-2006 11:07 | 85K | |
| ipcpage.txt | 05-Sep-2003 17:00 | 73K | |
| linux_io.ppt | 17-Sep-2007 13:05 | 176K | |
| linux_kernel.ppt | 10-Oct-2002 07:11 | 249K | |
| memory_management.ppt | 16-Sep-2003 08:57 | 132K | |
| migration.ppt | 10-Nov-2002 22:03 | 858K | |
| multirealscheduling.ppt | 09-Mar-2003 11:00 | 54K | |
| network code.ppt | 04-Nov-2003 14:54 | 33K | |
| processe2.ppt | 24-Dec-2007 16:45 | 189K | |
| processes.ppt | 05-Aug-2002 21:17 | 37K | |
| processes_linux.ppt | 02-Sep-2003 08:56 | 45K | |
| process states.ppt | 21-Aug-2003 14:53 | 56K | |
| scheduling.ppt | 18-Sep-2003 08:38 | 391K | |
| semaphore2.ppt | 16-Jan-2008 12:29 | 236K | |
| semaphores.ppt | 22-Dec-2007 11:23 | 97K | |
| slide_index-calendar format.htm | 19-Dec-2006 18:32 | 50K | |
| slide_index - old format.htm | 13-Aug-2007 23:01 | 92K | |
| slide_index - old format_files/ | 13-Aug-2007 23:01 | - | |
| slide_index - old format_s07.htm | 13-Aug-2007 22:58 | 92K | |
| slide_index - old format_s07_files/ | 13-Aug-2007 22:58 | - | |
| slide_index - s08.htm | 03-Jan-2008 18:48 | 90K | |
| slide_index - s08_files/ | 03-Jan-2008 18:48 | - | |
| slide_index.htm | 05-Jan-2009 05:39 | 93K | |
| slide_index_files/ | 07-Jan-2009 11:41 | - | |
| stallings readerwriter.ppt | 24-Aug-2005 22:48 | 52K | |
| stallingssems.rtf | 03-Sep-2002 06:40 | 22K | |
| stevens_msg/ | 16-Jan-2007 20:55 | - | |
| tanenbaumphils.rtf | 28-Aug-2003 07:57 | 12K | |
| windows networking.ppt | 25-Oct-2007 08:54 | 38K | |